|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-GENERIC-RXN ALCOHOL-DEHYDROG-GENERIC-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O |
| * common name: | | * common name: |
− | ** polyketide_synthase | + | ** γ-L-glutamyl 5-phosphate |
− | ** ORF | + | * inchi key: |
− | * ec number: | + | ** InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L |
− | ** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1] | + | * molecular weight: |
| + | ** 225.094 |
| * Synonym(s): | | * Synonym(s): |
| + | ** L-glutamate 5-phosphate |
| + | ** γ-L-glutamyl-5-P |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[G5DH]] |
− | ** 1 [[NAD]][c] '''+''' 1 [[Primary-Alcohols]][c] '''<=>''' 1 [[Aldehydes]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
| + | * [[GLUTSEMIALDEHYDROG-RXN]] |
− | * With common name(s):
| + | * [[G5DHm]] |
− | ** 1 NAD+[c] '''+''' 1 a primary alcohol[c] '''<=>''' 1 an aldehyde[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
| + | == Reaction(s) known to produce the compound == |
− | | + | * [[GLUTKIN-RXN]] |
− | == Genes associated with this reaction ==
| + | == Reaction(s) of unknown directionality == |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_5425]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_5424]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_6563]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_7649]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_6562]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]] | + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * BIGG : glu5p |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10739 10739] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44457531 44457531] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R07326 R07326] | + | * HMDB : HMDB01228 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P04707 P04707] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03287 C03287] |
− | ** [http://www.uniprot.org/uniprot/P21898 P21898]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P07160 P07160]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58274 58274] |
− | ** [http://www.uniprot.org/uniprot/P07754 P07754] | + | * METABOLIGHTS : MTBLC58274 |
− | ** [http://www.uniprot.org/uniprot/P06758 P06758]
| + | {{#set: smiles=C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/P06757 P06757]
| + | {{#set: common name=γ-L-glutamyl 5-phosphate}} |
− | ** [http://www.uniprot.org/uniprot/Q64564 Q64564]
| + | {{#set: inchi key=InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L}} |
− | ** [http://www.uniprot.org/uniprot/P08843 P08843]
| + | {{#set: molecular weight=225.094 }} |
− | ** [http://www.uniprot.org/uniprot/P14940 P14940]
| + | {{#set: common name=L-glutamate 5-phosphate|γ-L-glutamyl-5-P}} |
− | ** [http://www.uniprot.org/uniprot/P19854 P19854]
| + | {{#set: consumed by=G5DH|GLUTSEMIALDEHYDROG-RXN|G5DHm}} |
− | ** [http://www.uniprot.org/uniprot/P20368 P20368]
| + | {{#set: produced by=GLUTKIN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P19631 P19631]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22797 P22797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22246 P22246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05847 Q05847]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09009 Q09009]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03384 Q03384]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26325 P26325]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12311 P12311]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39462 P39462]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25988 P25988]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64673 Q64673]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41680 P41680]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33744 P33744]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81431 P81431]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64437 Q64437]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28474 P28474]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17648 P17648]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1S7 Q7M1S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23361 P23361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07161 P07161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33010 P33010]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41681 P41681]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23277 P23277]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09010 Q09010]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23278 P23278]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25437 P25437]
| + | |
− | ** [http://www.uniprot.org/uniprot/O06012 O06012]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10127 P10127]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00330 P00330]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00331 P00331]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23991 P23991]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9Q7 P0A9Q7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00334 P00334]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10807 P10807]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00327 P00327]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00328 P00328]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28332 P28332]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07327 P07327]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00325 P00325]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00326 P00326]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08319 P08319]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40394 P40394]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11766 P11766]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14219 P14219]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13603 P13603]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00329 P00329]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06525 P06525]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25141 P25141]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14675 P14675]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14674 P14674]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14673 P14673]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12711 P12711]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18332 P18332]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00332 P00332]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22245 P22245]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77316 P77316]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRB0 Q9JRB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CEN0 Q9CEN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44557 P44557]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9K0P0 Q9K0P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVR8 Q9JVR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28469 P28469]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64533 Q64533]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64415 Q64415]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40249 Q40249]
| + | |
− | ** [http://www.uniprot.org/uniprot/P79896 P79896]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06099 Q06099]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07588 Q07588]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51635 P51635]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20306 P20306]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Z9 Q7M4Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12886 P12886]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05336 P05336]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09369 P09369]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09370 P09370]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10847 P10847]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10848 P10848]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00333 P00333]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43264 Q43264]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12854 P12854]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q6LCE4 Q6LCE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P84328 P84328]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9GN94 Q9GN94]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20369 P20369]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07162 P07162]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07159 P07159]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23237 P23237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23236 P23236]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25139 P25139]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49384 P49384]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q24641 Q24641]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26719 P26719]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30350 P30350]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49383 P49383]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37473 P37473]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27595 Q27595]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03505 Q03505]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32771 P32771]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07288 Q07288]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42328 P42328]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38113 P38113]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48815 P48815]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42327 P42327]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37686 P37686]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80338 P80338]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50381 P50381]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80360 P80360]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46415 P46415]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28032 P28032]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41241 Q41241]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41242 Q41242]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43067 P43067]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07321 Q07321]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43016 Q43016]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07246 P07246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09669 Q09669]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59399 Q59399]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48977 P48977]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42953 Q42953]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25405 P25405]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25406 P25406]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80512 P80512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54202 P54202]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZI0 Q7LZI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49645 P49645]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64563 Q64563]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80467 P80467]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96533 Q96533]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26653 Q26653]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42764 Q42764]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39782 Q39782]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39783 Q39783]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42765 Q42765]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZ46 Q7LZ46]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73138 P73138]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41767 Q41767]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43169 Q43169]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49054 O49054]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49061 O49061]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49053 O49053]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49058 O49058]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82791 O82791]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94038 O94038]
| + | |
− | ** [http://www.uniprot.org/uniprot/O45687 O45687]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17334 Q17334]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UAT1 Q9UAT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RI47 Q9RI47]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78870 P78870]
| + | |
− | ** [http://www.uniprot.org/uniprot/O74540 O74540]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65459 O65459]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9P6C8 Q9P6C8]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=polyketide_synthase}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: ec number=EC-1.1.1.1}} | + | |
− | {{#set: gene associated=Tiso_gene_5425|Tiso_gene_5424|Tiso_gene_6563|Tiso_gene_7649|Tiso_gene_6562}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |