Difference between revisions of "SERSYN-PWY"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * common name: ** 3-cyanopy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(=CN=CC=C1))#N |
* common name: | * common name: | ||
− | ** | + | ** 3-cyanopyridine |
+ | * inchi key: | ||
+ | ** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 104.111 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[R313-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 100-54-9 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.78.html 78] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556] | ||
+ | * NCI: | ||
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558] | ||
+ | {{#set: smiles=C(C1(=CN=CC=C1))#N}} | ||
+ | {{#set: common name=3-cyanopyridine}} | ||
+ | {{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=104.111 }} | ||
+ | {{#set: consumed by=R313-RXN}} |
Revision as of 16:02, 21 March 2018
Contents
Metabolite 3-CYANOPYRIDINE
- smiles:
- C(C1(=CN=CC=C1))#N
- common name:
- 3-cyanopyridine
- inchi key:
- InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
- molecular weight:
- 104.111
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links