Difference between revisions of "PWY-1722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5822 RXN-5822] == * direction: ** LEFT-TO-RIGHT * common name: ** purple_acid_phosphatase-like_...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5822 RXN-5822] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** purple_acid_phosphatase-like_protein |
− | * | + | ** alkaline_phosphatase_d |
− | ** | + | ** acid_phosphatase |
+ | ** ORF | ||
+ | ** alkaline_phosphatase | ||
+ | ** histidine_acid_phosphatase_domain_containing_2a | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.1.3.2 EC-3.1.3.2] | ||
+ | ** [http://enzyme.expasy.org/EC/3.1.3.1 EC-3.1.3.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[NAD]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 NADP+[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 NAD+[c] |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_9372]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | == | + | * Gene: [[Tiso_gene_17309]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_15256]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_3271]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_8159]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10738]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5996]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17310]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5083]], NAD/NADH phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[NADPHOS-DEPHOS-PWY]], NAD phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY NADPHOS-DEPHOS-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[NAD-BIOSYNTHESIS-II]], NAD salvage pathway III: [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28050 28050] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00118 R00118] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=purple_acid_phosphatase-like_protein}} |
− | + | {{#set: common name=alkaline_phosphatase_d}} | |
− | + | {{#set: common name=acid_phosphatase}} | |
− | + | {{#set: common name=ORF}} | |
− | {{#set: | + | {{#set: common name=alkaline_phosphatase}} |
− | {{#set: | + | {{#set: common name=histidine_acid_phosphatase_domain_containing_2a}} |
− | {{#set: common name= | + | {{#set: ec number=EC-3.1.3.2}} |
− | {{#set: | + | {{#set: ec number=EC-3.1.3.1}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_9372|Tiso_gene_17309|Tiso_gene_15256|Tiso_gene_3271|Tiso_gene_8159|Tiso_gene_10738|Tiso_gene_5996|Tiso_gene_17310}} |
− | {{#set: | + | {{#set: in pathway=PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 15:02, 21 March 2018
Contents
Reaction RXN-5822
- direction:
- LEFT-TO-RIGHT
- common name:
- purple_acid_phosphatase-like_protein
- alkaline_phosphatase_d
- acid_phosphatase
- ORF
- alkaline_phosphatase
- histidine_acid_phosphatase_domain_containing_2a
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADP+[c] + 1 H2O[c] => 1 phosphate[c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9372
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17309
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15256
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3271
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8159
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10738
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5996
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17310
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5083, NAD/NADH phosphorylation and dephosphorylation: PWY-5083
- 3 reactions found over 6 reactions in the full pathway
- NADPHOS-DEPHOS-PWY, NAD phosphorylation and dephosphorylation: NADPHOS-DEPHOS-PWY
- 2 reactions found over 3 reactions in the full pathway
- NAD-BIOSYNTHESIS-II, NAD salvage pathway III: NAD-BIOSYNTHESIS-II
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links