Difference between revisions of "THIAZOLSYN3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta17-C36-ACPs cis-delta17-C36-ACPs] == * common name: ** a cis-delta17-C36:1-[acp] * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * smiles: ** C(=O)([O-])CNC(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1) | ||
* common name: | * common name: | ||
| − | ** | + | ** 2,4-dinitrophenyl-S-glutathione |
| + | * inchi key: | ||
| + | ** InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M | ||
| + | * molecular weight: | ||
| + | ** 472.406 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** DNP-SG | ||
| + | ** S-(2,4-dinitrophenyl)glutathione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GST-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25322932 25322932] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8927 8927] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11175 C11175] | ||
| + | {{#set: smiles=C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)}} | ||
| + | {{#set: common name=2,4-dinitrophenyl-S-glutathione}} | ||
| + | {{#set: inchi key=InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M}} | ||
| + | {{#set: molecular weight=472.406 }} | ||
| + | {{#set: common name=DNP-SG|S-(2,4-dinitrophenyl)glutathione}} | ||
| + | {{#set: reversible reaction associated=GST-RXN}} | ||
Revision as of 15:02, 21 March 2018
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- smiles:
- C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)
- common name:
- 2,4-dinitrophenyl-S-glutathione
- inchi key:
- InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M
- molecular weight:
- 472.406
- Synonym(s):
- DNP-SG
- S-(2,4-dinitrophenyl)glutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)" cannot be used as a page name in this wiki.
