Difference between revisions of "PWY-7179-1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOy NODOy] == * direction: ** LEFT-TO-RIGHT * common name: ** nitric oxide, NADPH2:oxygen oxidore...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOy NODOy] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
+
 
* common name:
 
* common name:
−
** ribitol
+
** nitric oxide, NADPH2:oxygen oxidoreductase
−
* molecular weight:
+
−
** 152.147   
+
 
* Synonym(s):
 
* Synonym(s):
−
** meso-ribitol
 
−
** adonitol
 
−
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol
 
−
** D-ribitol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2.0 [[NITRIC-OXIDE]][c] '''+''' 2.0 [[OXYGEN-MOLECULE]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 2.0 [[NITRATE]][c]
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
* With common name(s):
 +
** 2.0 nitric oxide[c] '''+''' 2.0 oxygen[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 NADP+[c] '''+''' 1.0 H+[c] '''+''' 2.0 nitrate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4015]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 488-81-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=nitric oxide, NADPH2:oxygen oxidoreductase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474]
+
{{#set: gene associated=Tiso_gene_4015}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963]
+
{{#set: reconstruction category=orthology}}
−
* METABOLIGHTS : MTBLC15963
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB00508
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}}
+
−
{{#set: common name=ribitol}}
+
−
{{#set: molecular weight=152.147    }}
+
−
{{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}}
+
−
{{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
+

Revision as of 15:02, 21 March 2018

Reaction NODOy

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nitric oxide, NADPH2:oxygen oxidoreductase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7179-1&oldid=31976"