Difference between revisions of "PWY-6886"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
 +
* common name:
 +
** trans-3-hydroxycotinine-glucuronide
 +
* inchi key:
 +
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
 +
* molecular weight:
 +
** 367.335   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-13913]][c] '''=>''' 1 [[CPD-13912]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN66-162]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 2-carboxy-L-xylonolactone[c] '''=>''' 1 2-carboxy-L-threo-pentonate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-6959}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB01204
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
 +
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
 +
{{#set: molecular weight=367.335    }}
 +
{{#set: produced by=RXN66-162}}

Revision as of 15:02, 21 March 2018

Metabolite CPD-2752

  • smiles:
    • C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
  • common name:
    • trans-3-hydroxycotinine-glucuronide
  • inchi key:
    • InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
  • molecular weight:
    • 367.335
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6886&oldid=32001"