Difference between revisions of "THIAMINE-PYROPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-38254 TAX-382...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-38254 TAX-38254] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2830 TAX-2830] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-543769 TAX-543769] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33634 TAX-33634] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3027 TAX-3027] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** photorespiration |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** C2 photorespiratory carbon oxidation cycle | ||
+ | ** PCO cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''9''' reactions in the full pathway | |
− | * [[RXN- | + | * [[GLY3KIN-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_3016]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[GLYCERATE-DEHYDROGENASE-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[GLYCINE-AMINOTRANSFERASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_5959]] | ||
+ | *** [[Tiso_gene_20557]] | ||
+ | *** [[Tiso_gene_1695]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[GLYOHMETRANS-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_16153]] | ||
+ | *** [[Tiso_gene_7776]] | ||
+ | *** [[Tiso_gene_18652]] | ||
+ | *** [[Tiso_gene_16154]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[GPH-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_18052]] | ||
+ | *** [[Tiso_gene_18053]] | ||
+ | *** [[Tiso_gene_18054]] | ||
+ | *** [[Tiso_gene_15498]] | ||
+ | *** [[Tiso_gene_8723]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GCVMULTI-RXN GCVMULTI-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-961 RXN-961] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-969 RXN-969] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SERINE-GLYOXYLATE-AMINOTRANSFERASE-RXN SERINE-GLYOXYLATE-AMINOTRANSFERASE-RXN] | ||
== External links == | == External links == | ||
− | * | + | * METACYC: |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-181 PWY-181] |
− | {{#set: | + | {{#set: taxonomic range=TAX-38254}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2830}} |
− | {{#set: common name= | + | {{#set: taxonomic range=TAX-543769}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-33634}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-3027}} |
+ | {{#set: taxonomic range=TAX-33682}} | ||
+ | {{#set: taxonomic range=TAX-2763}} | ||
+ | {{#set: taxonomic range=TAX-1117}} | ||
+ | {{#set: taxonomic range=TAX-33090}} | ||
+ | {{#set: common name=photorespiration}} | ||
+ | {{#set: common name=C2 photorespiratory carbon oxidation cycle|PCO cycle}} | ||
+ | {{#set: reaction found=5}} | ||
+ | {{#set: total reaction=9}} | ||
+ | {{#set: completion rate=56.0}} |
Revision as of 15:02, 21 March 2018
Pathway PWY-181
- taxonomic range:
- common name:
- photorespiration
- Synonym(s):
- C2 photorespiratory carbon oxidation cycle
- PCO cycle
Reaction(s) found
5 reactions found over 9 reactions in the full pathway
- GLY3KIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- GLYCERATE-DEHYDROGENASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- GLYCINE-AMINOTRANSFERASE-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- GLYOHMETRANS-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- GPH-RXN
- 5 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- METACYC: