Difference between revisions of "PWY-7411"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_7561 == * right end position: ** 11030 * transcription direction: ** POSITIVE * left end position: ** 1767 * centisome position: ** 16.0170...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7561 == |
− | * | + | * right end position: |
− | ** | + | ** 11030 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1767 |
− | * | + | * centisome position: |
− | ** | + | ** 16.01704 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.1.4.11-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-13334]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16261]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6367]] | ||
+ | * [[PWY-6351]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[LIPASYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11030}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1767}} | |
− | + | {{#set: centisome position=16.01704 }} | |
− | + | {{#set: reaction associated=3.1.4.11-RXN|RXN-13334|RXN-16261}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:05, 21 March 2018
Gene Tiso_gene_7561
- right end position:
- 11030
- transcription direction:
- POSITIVE
- left end position:
- 1767
- centisome position:
- 16.01704
- Synonym(s):
Reactions associated
- Reaction: 3.1.4.11-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13334
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16261
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation