Difference between revisions of "Thiols"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * common name: ** L-tryptopha...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
 
* common name:
 
* common name:
−
** Arg/N-end rule pathway (eukaryotic)
+
** L-tryptophan
 +
* inchi key:
 +
** InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N
 +
* molecular weight:
 +
** 204.228   
 
* Synonym(s):
 
* Synonym(s):
 +
** trp
 +
** W
 +
** tryptacin
 +
** trofan
 +
** tryptophan
 +
** 2-amino-3-indolylpropanic acid
 +
** L-trp
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''8''' reactions found over '''14''' reactions in the full pathway
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
−
* [[RXN-17850]]
+
* [[RME144]]
−
** 0 associated gene:
+
* [[TRANS-RXN-76]]
−
** 2 reconstruction source(s) associated:
+
== Reaction(s) known to produce the compound ==
−
*** [[annotation-in-silico_annotation]]
+
* [[TRYPSYN-RXN]]
−
*** [[annotation-experimental_annotation]]
+
* [[RXN0-2382]]
−
* [[RXN-17851]]
+
* [[TRANS-RXN-76]]
−
** 0 associated gene:
+
== Reaction(s) of unknown directionality ==
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-17874]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_4247]]
+
−
*** [[Tiso_gene_5715]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-17881]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-17882]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-17883]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-17892]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_3550]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-17893]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_3550]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17849 RXN-17849]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17879 RXN-17879]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17889 RXN-17889]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17890 RXN-17890]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17891 RXN-17891]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33208}}
+
* CAS : 73-22-3
−
{{#set: taxonomic range=TAX-33090}}
+
* BIGG : trp__L
−
{{#set: common name=Arg/N-end rule pathway (eukaryotic)}}
+
* PUBCHEM:
−
{{#set: reaction found=8}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923516 6923516]
−
{{#set: total reaction=14}}
+
* HMDB : HMDB00929
−
{{#set: completion rate=57.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00078 C00078]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57912 57912]
 +
* METABOLIGHTS : MTBLC57912
 +
{{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}}
 +
{{#set: common name=L-tryptophan}}
 +
{{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N}}
 +
{{#set: molecular weight=204.228    }}
 +
{{#set: common name=trp|W|tryptacin|trofan|tryptophan|2-amino-3-indolylpropanic acid|L-trp}}
 +
{{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN|RME144|TRANS-RXN-76}}
 +
{{#set: produced by=TRYPSYN-RXN|RXN0-2382|TRANS-RXN-76}}

Revision as of 15:05, 21 March 2018

Metabolite TRP

  • smiles:
    • C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
  • common name:
    • L-tryptophan
  • inchi key:
    • InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N
  • molecular weight:
    • 204.228
  • Synonym(s):
    • trp
    • W
    • tryptacin
    • trofan
    • tryptophan
    • 2-amino-3-indolylpropanic acid
    • L-trp

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 73-22-3
  • BIGG : trp__L
  • PUBCHEM:
  • HMDB : HMDB00929
  • LIGAND-CPD:
  • CHEBI:
  • METABOLIGHTS : MTBLC57912
"C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Thiols&oldid=32352"