Difference between revisions of "DHAP pi thr"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEMEFERROCHELAT-RXN PROTOHEMEFERROCHELAT-RXN] == * direction: ** REVERSIBLE * common name: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEMEFERROCHELAT-RXN PROTOHEMEFERROCHELAT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ferrochelatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.99.1.1 EC-4.99.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PROTOHEME]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[FE+2]][c] '''+''' 1 [[PROTOPORPHYRIN_IX]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ferroheme b[c] '''+''' 2 H+[c] '''<=>''' 1 Fe2+[c] '''+''' 1 protoporphyrin IX[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3284]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_15900]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY0-1415]], superpathway of heme biosynthesis from uroporphyrinogen-III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1415 PWY0-1415] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[HEMESYN2-PWY]], heme biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[HEME-BIOSYNTHESIS-II]], heme biosynthesis I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEME-BIOSYNTHESIS-II HEME-BIOSYNTHESIS-II] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22584 22584] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00310 R00310] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22830 P22830] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22315 P22315] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28602 P28602] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q05338 Q05338] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P42043 P42043] |
+ | ** [http://www.uniprot.org/uniprot/P23871 P23871] | ||
+ | ** [http://www.uniprot.org/uniprot/P32396 P32396] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9CFB4 Q9CFB4] | ||
+ | ** [http://www.uniprot.org/uniprot/P56107 P56107] | ||
+ | ** [http://www.uniprot.org/uniprot/O67083 O67083] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PI08 Q9PI08] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JVA5 Q9JVA5] | ||
+ | ** [http://www.uniprot.org/uniprot/P22600 P22600] | ||
+ | ** [http://www.uniprot.org/uniprot/P43868 P43868] | ||
+ | ** [http://www.uniprot.org/uniprot/P16622 P16622] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59735 Q59735] | ||
+ | ** [http://www.uniprot.org/uniprot/P43413 P43413] | ||
+ | ** [http://www.uniprot.org/uniprot/P54225 P54225] | ||
+ | ** [http://www.uniprot.org/uniprot/P42045 P42045] | ||
+ | ** [http://www.uniprot.org/uniprot/O64391 O64391] | ||
+ | ** [http://www.uniprot.org/uniprot/P42044 P42044] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=ferrochelatase}} | ||
+ | {{#set: ec number=EC-4.99.1.1}} | ||
+ | {{#set: gene associated=Tiso_gene_3284|Tiso_gene_15900}} | ||
+ | {{#set: in pathway=PWY0-1415|HEMESYN2-PWY|HEME-BIOSYNTHESIS-II}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 15:06, 21 March 2018
Contents
Reaction PROTOHEMEFERROCHELAT-RXN
- direction:
- REVERSIBLE
- common name:
- ferrochelatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTOHEME[c] + 2 PROTON[c] <=> 1 FE+2[c] + 1 PROTOPORPHYRIN_IX[c]
- With common name(s):
- 1 ferroheme b[c] + 2 H+[c] <=> 1 Fe2+[c] + 1 protoporphyrin IX[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3284
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15900
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
- PWY0-1415, superpathway of heme biosynthesis from uroporphyrinogen-III: PWY0-1415
- 5 reactions found over 6 reactions in the full pathway
- HEMESYN2-PWY, heme biosynthesis II (anaerobic): HEMESYN2-PWY
- 3 reactions found over 4 reactions in the full pathway
- HEME-BIOSYNTHESIS-II, heme biosynthesis I (aerobic): HEME-BIOSYNTHESIS-II
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: