Difference between revisions of "Tiso gene 14560"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8689 == * Synonym(s): == Reactions associated == * 3.2.1.39-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
+ | * common name: | ||
+ | ** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J | ||
+ | * molecular weight: | ||
+ | ** 987.845 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA | ||
+ | ** (S)-3-hydroxy-14:1-Δ5-CoA | ||
+ | ** (3S)-hydroxy-5-cis-tetradecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14393]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729] | ||
+ | {{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
+ | {{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}} | ||
+ | {{#set: molecular weight=987.845 }} | ||
+ | {{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14393}} |
Revision as of 15:06, 21 March 2018
Contents
Metabolite CPD0-1163
- smiles:
- CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
- molecular weight:
- 987.845
- Synonym(s):
- (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
- (S)-3-hydroxy-14:1-Δ5-CoA
- (3S)-hydroxy-5-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.