Difference between revisions of "D-Glucopyranuronate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=IEZWLIJBCD...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4395 == * left end position: ** 2834 * transcription direction: ** POSITIVE * right end position: ** 3849 * centisome position: ** 19.04186...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
+
== Gene Tiso_gene_4395 ==
* smiles:
+
* left end position:
** CSCCCCCCCCC(=O)C([O-])=O
+
** 2834
* inchi key:
+
* transcription direction:
** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
+
** POSITIVE
* common name:
+
* right end position:
** 10-(methylthio)-2-oxodecanoate
+
** 3849
* molecular weight:
+
* centisome position:
** 231.329    
+
** 19.04186    
 
* Synonym(s):
 
* Synonym(s):
** 10-(methylthio)-2-oxo-decanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
* [[RXN-18201]]
+
** in-silico_annotation
* [[RXNQT-4178]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2834}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295]
+
{{#set: transcription direction=POSITIVE}}
* KNAPSACK : C00007651
+
{{#set: right end position=3849}}
{{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}}
+
{{#set: centisome position=19.04186   }}
{{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: common name=10-(methylthio)-2-oxodecanoate}}
+
{{#set: molecular weight=231.329   }}
+
{{#set: common name=10-(methylthio)-2-oxo-decanoic acid}}
+
{{#set: produced by=RXN-18201|RXNQT-4178}}
+

Revision as of 17:09, 10 January 2018

Gene Tiso_gene_4395

  • left end position:
    • 2834
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3849
  • centisome position:
    • 19.04186
  • Synonym(s):

Reactions associated

Pathways associated

External links