Difference between revisions of "CYSTEINE-DEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-76 TRANS-RXN-76] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-76 TRANS-RXN-76] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[TRP]][e] '''+''' 1 [[PROTON]][e] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[TRP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 L-tryptophan[e] '''+''' 1 H+[e] '''=>''' 1 H+[c] '''+''' 1 L-tryptophan[c] | |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | * [[ | + | * Gene: [[Tiso_gene_19802]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | + | == Pathways == | |
− | * [[ | + | == Reconstruction information == |
− | * [[ | + | * Category: [[orthology]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | + | *** Tool: [[pantograph]] | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: gene associated=Tiso_gene_19802}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:06, 21 March 2018
Contents
Reaction TRANS-RXN-76
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-tryptophan[e] + 1 H+[e] => 1 H+[c] + 1 L-tryptophan[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19802
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii