Difference between revisions of "Tiso gene 10532"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * smiles: ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J
+
 
* common name:
 
* common name:
** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA
+
** ethanol degradation III
* molecular weight:
+
** 1072.006   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-14484]]
+
* [[ACETATE--COA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_3617]]
 +
*** [[Tiso_gene_1612]]
 +
*** [[Tiso_gene_3616]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN66-3]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_7322]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-2 RXN66-2]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763]
+
{{#set: common name=ethanol degradation III}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387]
+
{{#set: total reaction=3}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: completion rate=67.0}}
{{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}}
+
{{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: molecular weight=1072.006    }}
+
{{#set: produced by=RXN-14484}}
+

Revision as of 15:07, 21 March 2018

Pathway PWY66-161

  • taxonomic range:
  • common name:
    • ethanol degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links