Difference between revisions of "RXN-16067"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[CU+2]][e] '''=>''' 1.0 [[CU+2]][c] |
− | + | * With common name(s): | |
− | + | ** 1.0 Cu2+[e] '''=>''' 1.0 Cu2+[c] | |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | + | == Pathways == | |
− | == | + | == Reconstruction information == |
− | + | * Category: [[manual]] | |
− | + | ** Source: [[manual-import_from_medium]] | |
− | * [[ | + | *** Comment: [[added to manage seeds from extracellular to cytosol compartment]] |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-import_from_medium}} | |
− | + | {{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:08, 21 March 2018
Contents
Reaction TransportSeed_CU+2
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual