Difference between revisions of "CPD-17355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == * smiles: ** C[N+](C)(C[CH]=O)C * inchi key: ** InChIKey=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307] ==
* smiles:
+
* taxonomic range:
** C[N+](C)(C[CH]=O)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
* inchi key:
+
** InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** betaine aldehyde
+
** gentiodelphin biosynthesis
* molecular weight:
+
** 102.156   
+
 
* Synonym(s):
 
* Synonym(s):
** glycine betaine aldehyde
 
** N,N,N-trimethyl-2-oxoethylammonium
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17758]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-8228]]
* [[RXN0-7230]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3452]]
* [[BADH-RXN]]
+
** 1 reconstruction source(s) associated:
* [[CHD-RXN]]
+
*** [[orthology-athaliana]]
* [[RXN-6268]]
+
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8231 RXN-8231]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8232 RXN-8232]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8233 RXN-8233]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8234 RXN-8234]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8235 RXN-8235]
 
== External links  ==
 
== External links  ==
* CAS : 7418-61-3
+
{{#set: taxonomic range=TAX-3398}}
* METABOLIGHTS : MTBLC15710
+
{{#set: common name=gentiodelphin biosynthesis}}
* DRUGBANK : DB04401
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=6}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=249 249]
+
{{#set: completion rate=17.0}}
* HMDB : HMDB01252
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00576 C00576]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.244.html 244]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15710 15710]
+
* BIGG : betald
+
{{#set: smiles=C[N+](C)(C[CH]=O)C}}
+
{{#set: inchi key=InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N}}
+
{{#set: common name=betaine aldehyde}}
+
{{#set: molecular weight=102.156    }}
+
{{#set: common name=glycine betaine aldehyde|N,N,N-trimethyl-2-oxoethylammonium}}
+
{{#set: consumed by=RXN-17758}}
+
{{#set: produced by=RXN0-7230}}
+
{{#set: reversible reaction associated=BADH-RXN|CHD-RXN|RXN-6268}}
+

Revision as of 15:08, 21 March 2018

Pathway PWY-5307

  • taxonomic range:
  • common name:
    • gentiodelphin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links