Difference between revisions of "XYLITOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] == * smiles: ** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADCLY-RXN ADCLY-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/4.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADCLY-RXN ADCLY-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J
+
** [http://enzyme.expasy.org/EC/4.1.3.38 EC-4.1.3.38]
−
* common name:
+
−
** (S)-3-hydroxydodecanoyl-CoA
+
−
* molecular weight:
+
−
** 961.807   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[4-AMINO-4-DEOXYCHORISMATE]][c] '''<=>''' 1 [[P-AMINO-BENZOATE]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[PROTON]][c]
−
* [[HACD5m]]
+
* With common name(s):
−
* [[HACD5]]
+
** 1 4-amino-4-deoxychorismate[c] '''<=>''' 1 4-aminobenzoate[c] '''+''' 1 pyruvate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17748]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_614]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-6543]], 4-aminobenzoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6543 PWY-6543]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05262 C05262]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16201 16201]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62558 62558]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05553 R05553]
−
* BIGG : 3hddcoa
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: ec number=EC-4.1.3.38}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173081 46173081]
+
{{#set: gene associated=Tiso_gene_17748|Tiso_gene_614}}
−
* HMDB : HMDB03936
+
{{#set: in pathway=PWY-6543}}
−
{{#set: smiles=CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}}
−
{{#set: common name=(S)-3-hydroxydodecanoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=961.807    }}
+
−
{{#set: reversible reaction associated=HACD5m|HACD5}}
+

Revision as of 15:09, 21 March 2018

Reaction ADCLY-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6543, 4-aminobenzoate biosynthesis: PWY-6543
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=XYLITOL&oldid=32615"