Difference between revisions of "PWY-5443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** L-cysteine biosynthesis III (from L-homocysteine)
+
** 24-methylenecholesterol
 +
* inchi key:
 +
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
−
** L-homocysteine degradation
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[RXN-707]]
−
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_7852]]
+
−
*** [[Tiso_gene_3732]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-creinhardtii]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-14048]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_3732]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-15121]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-15123]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-MAP:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?map00660 map00660]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
−
{{#set: taxonomic range=TAX-33154}}
+
* HMDB : HMDB06849
−
{{#set: taxonomic range=TAX-2157}}
+
* LIGAND-CPD:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
−
{{#set: common name=L-cysteine biosynthesis III (from L-homocysteine)}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: common name=L-homocysteine degradation}}
+
{{#set: common name=24-methylenecholesterol}}
−
{{#set: reaction found=4}}
+
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
−
{{#set: total reaction=4}}
+
{{#set: molecular weight=398.671    }}
−
{{#set: completion rate=100.0}}
+
{{#set: produced by=RXN-707}}

Revision as of 15:09, 21 March 2018

Metabolite CPD-706

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 24-methylenecholesterol
  • inchi key:
    • InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5443&oldid=32646"