Difference between revisions of "RXN-5466"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * smiles: ** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * common name: ** phyte...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phytenal |
+ | * inchi key: | ||
+ | ** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 294.52 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2E-phytenal | ||
+ | ** 3,7,11,15-tetramethyl-2E-hexadecenal | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-479]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-478]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0104010025 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764] |
− | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}} | |
− | + | {{#set: common name=phytenal}} | |
− | + | {{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}} | |
− | + | {{#set: molecular weight=294.52 }} | |
− | + | {{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}} | |
− | + | {{#set: consumed by=RXN66-479}} | |
− | + | {{#set: produced by=RXN66-478}} | |
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:10, 21 March 2018
Contents
Metabolite CPD-14926
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
- common name:
- phytenal
- inchi key:
- InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
- molecular weight:
- 294.52
- Synonym(s):
- 2E-phytenal
- 3,7,11,15-tetramethyl-2E-hexadecenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR0104010025
- PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.