Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11059 RXN-11059] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11059 RXN-11059] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
+
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
−
* common name:
+
−
** 6α-hydroxy-castasterone
+
−
* molecular weight:
+
−
** 466.7   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hydroxydeoxocastasterone
 
−
** 6α-hydroxy-6-deoxocastasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-779]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PAPS]][c] '''+''' 1 [[N-ACETYL-SEROTONIN]][c] '''=>''' 1 [[CPD-12017]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN-778]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 N-acetyl-serotonin[c] '''=>''' 1 N-acetyl-serotonin sulfate[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5505]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699]
+
{{#set: ec number=EC-2.8.2.1}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5505}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760]
+
{{#set: in pathway=PWY-6398}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}}
+
−
{{#set: common name=6α-hydroxy-castasterone}}
+
−
{{#set: molecular weight=466.7    }}
+
−
{{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}}
+
−
{{#set: consumed by=RXN-779}}
+
−
{{#set: produced by=RXN-778}}
+

Revision as of 15:10, 21 March 2018

Reaction RXN-11059

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3'-phosphoadenylyl-sulfate[c] + 1 N-acetyl-serotonin[c] => 1 N-acetyl-serotonin sulfate[c] + 1 adenosine 3',5'-bisphosphate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6398, melatonin degradation I: PWY-6398
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ORNITHINE-CYCLODEAMINASE-RXN&oldid=32692"