Difference between revisions of "LEUCINE--TRNA-LIGASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2572 == * left end position: ** 7476 * transcription direction: ** POSITIVE * right end position: ** 10801 * centisome position: ** 39.4970...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == * smiles: ** C(=O)(C1(NC(CC1)=O))[O-] * common name: ** 5-oxo-L-p...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)(C1(NC(CC1)=O))[O-] |
− | * | + | * common name: |
− | ** | + | ** 5-oxo-L-proline |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 128.107 |
* Synonym(s): | * Synonym(s): | ||
+ | ** pyrrolidone-COO | ||
+ | ** pyrrolidone-carboxylate | ||
+ | ** L-5-pyrrolidone-2-carboxylic acid | ||
+ | ** L-pyroglutamic acid | ||
+ | ** 5-oxo-L-proline | ||
+ | ** pyroglutamic acid | ||
+ | ** pyroglutamate | ||
+ | ** 5-pyrrolidone-2-carboxylic acid | ||
+ | ** L-pyroglutamate | ||
+ | ** Pidolic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 98-79-3 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289118 5289118] |
− | {{#set: | + | * HMDB : HMDB00267 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01879 C01879] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4451146.html 4451146] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58402 58402] | ||
+ | {{#set: smiles=C(=O)(C1(NC(CC1)=O))[O-]}} | ||
+ | {{#set: common name=5-oxo-L-proline}} | ||
+ | {{#set: inchi key=InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M}} | ||
+ | {{#set: molecular weight=128.107 }} | ||
+ | {{#set: common name=pyrrolidone-COO|pyrrolidone-carboxylate|L-5-pyrrolidone-2-carboxylic acid|L-pyroglutamic acid|5-oxo-L-proline|pyroglutamic acid|pyroglutamate|5-pyrrolidone-2-carboxylic acid|L-pyroglutamate|Pidolic acid}} | ||
+ | {{#set: consumed by=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} | ||
+ | {{#set: produced by=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN}} |
Revision as of 15:10, 21 March 2018
Contents
Metabolite 5-OXOPROLINE
- smiles:
- C(=O)(C1(NC(CC1)=O))[O-]
- common name:
- 5-oxo-L-proline
- inchi key:
- InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M
- molecular weight:
- 128.107
- Synonym(s):
- pyrrolidone-COO
- pyrrolidone-carboxylate
- L-5-pyrrolidone-2-carboxylic acid
- L-pyroglutamic acid
- 5-oxo-L-proline
- pyroglutamic acid
- pyroglutamate
- 5-pyrrolidone-2-carboxylic acid
- L-pyroglutamate
- Pidolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(C1(NC(CC1)=O))[O-" cannot be used as a page name in this wiki.