Difference between revisions of "Tiso gene 915"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6185 PWY-6185] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6185 PWY-6185] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** ( | + | ** 4-methylcatechol degradation (ortho cleavage) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''7''' reactions in the full pathway |
− | == Reaction(s) | + | * [[RXN-10083]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == | + | *** [[Tiso_gene_10066]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=5.4.99.14-RXN 5.4.99.14-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10080 RXN-10080] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10081 RXN-10081] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10082 RXN-10082] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10085 RXN-10085] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10086 RXN-10086] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=4-methylcatechol degradation (ortho cleavage)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=14.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:11, 21 March 2018
Pathway PWY-6185
- taxonomic range:
- common name:
- 4-methylcatechol degradation (ortho cleavage)
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- RXN-10083
- 1 associated gene(s):
- 1 reconstruction source(s) associated: