Difference between revisions of "Tiso gene 17532"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279] ==
* smiles:
+
* taxonomic range:
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholest-7-en-3-one
+
** aerobic respiration II (cytochrome c) (yeast)
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[1.10.2.2-RXN]]
* [[1.1.1.170-RXN]]
+
** 5 associated gene(s):
 +
*** [[Tiso_gene_15926]]
 +
*** [[Tiso_gene_9627]]
 +
*** [[Tiso_gene_18330]]
 +
*** [[Tiso_gene_7235]]
 +
*** [[Tiso_gene_4973]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[CYTOCHROME-C-OXIDASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18580]]
 +
*** [[Tiso_gene_15682]]
 +
*** [[Tiso_gene_7948]]
 +
*** [[Tiso_gene_18053]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-5330]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18172]]
 +
*** [[Tiso_gene_18831]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345]
+
{{#set: common name=aerobic respiration II (cytochrome c) (yeast)}}
* CHEMSPIDER:
+
{{#set: reaction found=4}}
** [http://www.chemspider.com/Chemical-Structure.389311.html 389311]
+
{{#set: total reaction=4}}
* CHEBI:
+
{{#set: completion rate=100.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453]
+
* HMDB : HMDB11606
+
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}}
+
{{#set: common name=4α-methyl-5α-cholest-7-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: reversible reaction associated=1.1.1.170-RXN}}
+

Revision as of 15:12, 21 March 2018

Pathway PWY-7279

  • taxonomic range:
  • common name:
    • aerobic respiration II (cytochrome c) (yeast)
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links