Difference between revisions of "ATCDm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_18904 == * right end position: ** 2210 * transcription direction: ** POSITIVE * left end position: ** 686 * centisome position: ** 25.16507...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18904 == |
− | * | + | * right end position: |
− | ** | + | ** 2210 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 686 |
− | * | + | * centisome position: |
− | ** | + | ** 25.165077 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLYCLTD]] |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | == | + | * Reaction: [[PGLYCDEHYDROG-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[SERSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2210}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=686}} | |
− | + | {{#set: centisome position=25.165077 }} | |
− | + | {{#set: reaction associated=GLYCLTD|PGLYCDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=SERSYN-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:12, 21 March 2018
Gene Tiso_gene_18904
- right end position:
- 2210
- transcription direction:
- POSITIVE
- left end position:
- 686
- centisome position:
- 25.165077
- Synonym(s):
Reactions associated
- Reaction: GLYCLTD
- Source: orthology-creinhardtii
- Reaction: PGLYCDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation