Difference between revisions of "ZN+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-150 RXN1F-150] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-150 RXN1F-150] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L
+
** [http://enzyme.expasy.org/EC/5.5.1.19 EC-5.5.1.19]
−
* common name:
+
−
** dGMP
+
−
* molecular weight:
+
−
** 345.208   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-dG-5'-MP
 
−
** 2'-deoxyguanosine 5'-monophosphate
 
−
** guanine riboside
 
−
** vernine
 
−
** 2'-deoxyguanosine 5'-phosphate
 
−
** deoxyguanosine-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GMKALT-RXN]]
+
* With identifiers:
−
* [[ATDGM]]
+
** 1 [[CPD1F-114]][c] '''=>''' 1 [[CPD1F-126]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN0-385]]
+
** 1 all-trans-lycopene[c] '''=>''' 1 γ-carotene[c]
−
* [[DGSNPT]]
+
 
−
* [[RXN-14208]]
+
== Genes associated with this reaction  ==
−
* [[RXN-14218]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[DGTD]]
+
* Gene: [[Tiso_gene_11980]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
−
* [[DMPH]]
+
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_6282]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_4457]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_1547]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3577]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5943]], β-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5943 PWY-5943]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-7591]], okenone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7591 PWY-7591]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 902-04-5
+
* RHEA:
−
* METABOLIGHTS : MTBLC57673
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32222 32222]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6994968 6994968]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05341 R05341]
−
* HMDB : HMDB01044
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-5.5.1.19}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00362 C00362]
+
{{#set: gene associated=Tiso_gene_11980|Tiso_gene_6282|Tiso_gene_4457|Tiso_gene_1547|Tiso_gene_8263|Tiso_gene_3577}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-5943|PWY-7591}}
−
** [http://www.chemspider.com/Chemical-Structure.5362940.html 5362940]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57673 57673]
+
{{#set: reconstruction tool=pantograph}}
−
* BIGG : dgmp
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L}}
+
−
{{#set: common name=dGMP}}
+
−
{{#set: molecular weight=345.208    }}
+
−
{{#set: common name=2'-dG-5'-MP|2'-deoxyguanosine 5'-monophosphate|guanine riboside|vernine|2'-deoxyguanosine 5'-phosphate|deoxyguanosine-phosphate}}
+
−
{{#set: consumed by=GMKALT-RXN|ATDGM}}
+
−
{{#set: produced by=RXN0-385|DGSNPT|RXN-14208|RXN-14218|DGTD}}
+
−
{{#set: reversible reaction associated=DMPH}}
+

Revision as of 15:12, 21 March 2018

Reaction RXN1F-150

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans-lycopene[c] => 1 γ-carotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5943, β-carotene biosynthesis: PWY-5943
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-7591, okenone biosynthesis: PWY-7591
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ZN%2B2&oldid=32908"