Difference between revisions of "PWY-6642"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Gene == Gene Tiso_gene_3446 == * right end position: ** 12324 * transcription direction: ** POSITIVE * left end position: ** 11595 * centisome position: ** 69.518...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3446 == |
| − | * | + | * right end position: |
| − | ** | + | ** 12324 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 11595 |
| − | * | + | * centisome position: |
| − | ** | + | ** 69.518555 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[3-DEHYDROQUINATE-SYNTHASE-RXN]] | |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | == | + | == Pathways associated == |
| − | * [[ | + | * [[PWY-6164]] |
== External links == | == External links == | ||
| − | + | {{#set: right end position=12324}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=11595}} | |
| − | + | {{#set: centisome position=69.518555 }} | |
| − | + | {{#set: reaction associated=3-DEHYDROQUINATE-SYNTHASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6164}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 15:13, 21 March 2018
Gene Tiso_gene_3446
- right end position:
- 12324
- transcription direction:
- POSITIVE
- left end position:
- 11595
- centisome position:
- 69.518555
- Synonym(s):
Reactions associated
- Reaction: 3-DEHYDROQUINATE-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
