Difference between revisions of "PWY-5691"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidate_cytidylyltran...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] ==
* smiles:
+
* direction:
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
 
* common name:
 
* common name:
** β-ketovaleryl-CoA
+
** phosphatidate_cytidylyltransferase
* molecular weight:
+
* ec number:
** 861.604   
+
** [http://enzyme.expasy.org/EC/2.7.7.41 EC-2.7.7.41]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[2-3-4-Saturated-L-Phosphatidates]][c] '''+''' 1 [[CTP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CDP-2-3-4-Saturated-Diacylglycerols]][c] '''+''' 1 [[PPI]][c]
* [[RXN-12560]]
+
* With common name(s):
* [[RXN-12561]]
+
** 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 CTP[c] '''+''' 1 H+[c] '''=>''' 1 a CDP-2,3,4-saturated-diacylglycerol[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2311]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_3522]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3523]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
{{#set: common name=phosphatidate_cytidylyltransferase}}
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-2.7.7.41}}
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: gene associated=Tiso_gene_2311|Tiso_gene_3522|Tiso_gene_3523}}
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: in pathway=}}
{{#set: molecular weight=861.604    }}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: reversible reaction associated=RXN-12560|RXN-12561}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:13, 21 March 2018

Reaction RXN0-5515

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phosphatidate_cytidylyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links