Difference between revisions of "TransportSeed OXYGEN-MOLECULE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S2O3 S2O3] == * smiles: ** O=S(=O)([O-])S * inchi key: ** InChIKey=DHCDFWKWKRSZHF-UHFFFAOYSA-M...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == |
* smiles: | * smiles: | ||
− | ** O= | + | ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (2E)-5-methylhexa-2,4-dienoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 871.642 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468] |
− | + | {{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}} | |
− | + | {{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}} | |
− | + | {{#set: molecular weight=871.642 }} | |
− | + | {{#set: consumed by=RXN-11919}} | |
− | {{#set: smiles=O= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:13, 21 March 2018
Contents
Metabolite CPD-12904
- smiles:
- CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E)-5-methylhexa-2,4-dienoyl-CoA
- inchi key:
- InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
- molecular weight:
- 871.642
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.