Difference between revisions of "RXN0-5141"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * common name: ** O-acetyl-L-homoser...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(OCCC(C([O-])=O)[N+])=O |
* common name: | * common name: | ||
− | ** | + | ** O-acetyl-L-homoserine |
+ | * inchi key: | ||
+ | ** InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N | ||
+ | * molecular weight: | ||
+ | ** 161.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** acetylhomoserine |
+ | ** O-acetylhomoserine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[ACHMSSELCYSL]] | |
− | * [[ | + | * [[ACHMSSELCYSLh]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | * [[ACETYLHOMOSER-CYS-RXN]] | |
− | + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244888 25244888] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57716 57716] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57716 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01077 C01077] |
− | {{#set: | + | {{#set: smiles=CC(OCCC(C([O-])=O)[N+])=O}} |
+ | {{#set: common name=O-acetyl-L-homoserine}} | ||
+ | {{#set: inchi key=InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N}} | ||
+ | {{#set: molecular weight=161.157 }} | ||
+ | {{#set: common name=acetylhomoserine|O-acetylhomoserine}} | ||
+ | {{#set: consumed by=ACHMSSELCYSL|ACHMSSELCYSLh}} | ||
+ | {{#set: reversible reaction associated=ACETYLHOMOSER-CYS-RXN|HOMOSERINE-O-ACETYLTRANSFERASE-RXN}} |
Revision as of 15:14, 21 March 2018
Contents
Metabolite CPD-667
- smiles:
- CC(OCCC(C([O-])=O)[N+])=O
- common name:
- O-acetyl-L-homoserine
- inchi key:
- InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N
- molecular weight:
- 161.157
- Synonym(s):
- acetylhomoserine
- O-acetylhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OCCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.