Difference between revisions of "Tiso gene 2246"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5940 == * left end position: ** 226 * transcription direction: ** POSITIVE * right end position: ** 3048 * centisome position: ** 1.7744975...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5940 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
* left end position:
+
* smiles:
** 226
+
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** β-ketovaleryl-CoA
* right end position:
+
* inchi key:
** 3048
+
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
* centisome position:
+
* molecular weight:
** 1.7744975    
+
** 861.604    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CHORISMATEMUT-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[RXN-12560]]
** [[pantograph]]-[[athaliana]]
+
* [[RXN-12561]]
** [[pantograph]]-[[esiliculosus]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[PREPHENATEDEHYDRAT-RXN]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PHESYN]]
+
* [[PWY-6120]]
+
* [[PWY-3462]]
+
* [[PWY-3461]]
+
* [[PWY-7626]]
+
* [[PWY-7432]]
+
* [[TYRSYN]]
+
* [[PWY-6627]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=226}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
{{#set: right end position=3048}}
+
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: centisome position=1.7744975   }}
+
{{#set: common name=β-ketovaleryl-CoA}}
{{#set: reaction associated=CHORISMATEMUT-RXN|PREPHENATEDEHYDRAT-RXN}}
+
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
{{#set: pathway associated=PHESYN|PWY-6120|PWY-3462|PWY-3461|PWY-7626|PWY-7432|TYRSYN|PWY-6627}}
+
{{#set: molecular weight=861.604   }}
 +
{{#set: reversible reaction associated=RXN-12560|RXN-12561}}

Revision as of 15:14, 21 March 2018

Metabolite CPD-13534

  • smiles:
    • CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • β-ketovaleryl-CoA
  • inchi key:
    • InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
  • molecular weight:
    • 861.604
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.