Difference between revisions of "Protein-Tyrosines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** succinate to cytochrome bo oxidase electron transfer |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
| − | * [[ | + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| − | = | + | ** 1 reconstruction source(s) associated: |
| + | *** [[manual-primary_network]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5268 RXN0-5268] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1329 PWY0-1329] |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=succinate to cytochrome bo oxidase electron transfer}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:14, 21 March 2018
Pathway PWY0-1329
- taxonomic range:
- common name:
- succinate to cytochrome bo oxidase electron transfer
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
