Difference between revisions of "D-GALACTONO-1-4-LACTONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16307 == * Synonym(s): == Reactions associated == * RXN-12375 ** in-silico_annotation ***ec-number ** experimental_annotation ***ec-nu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * common name: ** 7,8-dihyd...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_16307 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
 +
* smiles:
 +
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
 +
* common name:
 +
** 7,8-dihydropterin
 +
* inchi key:
 +
** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 165.154   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydropterin
 +
** H2-pterin
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-12375]]
+
* [[RXN-15261]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
* [[RXN-12376]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-12377]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-6829]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-12375|RXN-12376|RXN-12377}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6829}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752]
 +
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}}
 +
{{#set: common name=7,8-dihydropterin}}
 +
{{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=165.154    }}
 +
{{#set: common name=dihydropterin|H2-pterin}}
 +
{{#set: consumed by=RXN-15261}}

Revision as of 15:14, 21 March 2018

Metabolite CPD0-1718

  • smiles:
    • C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
  • common name:
    • 7,8-dihydropterin
  • inchi key:
    • InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
  • molecular weight:
    • 165.154
  • Synonym(s):
    • dihydropterin
    • H2-pterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links