Difference between revisions of "PAPS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3042 TAX-3042]
−
** InChIKey=GJAWHXHKYYXBSV-UHFFFAOYSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
−
** quinolinate
+
** astaxanthin biosynthesis (bacteria, fungi, algae)
−
* molecular weight:
+
−
** 165.105   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-pyridinedicarboxylic acid
 
−
** 2,3-pyridinedicarboxylate
 
−
** quinolinic acid
 
−
** pyridine-2,3-dicarboxylic acid
 
−
** pyridine-2,3-dicarboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[QUINOPRIBOTRANS-RXN]]
+
'''2''' reactions found over '''10''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-8025]]
−
* [[RXN-5721]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_10837]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-8026]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10837]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8184 RXN-8184]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8185 RXN-8185]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8186 RXN-8186]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8187 RXN-8187]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8189 RXN-8189]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8190 RXN-8190]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8214 RXN-8214]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8215 RXN-8215]
 
== External links  ==
 
== External links  ==
−
* CAS : 89-00-9
+
{{#set: taxonomic range=TAX-2}}
−
* METABOLIGHTS : MTBLC29959
+
{{#set: taxonomic range=TAX-3042}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460301 5460301]
+
{{#set: common name=astaxanthin biosynthesis (bacteria, fungi, algae)}}
−
* HMDB : HMDB00232
+
{{#set: reaction found=2}}
−
* LIGAND-CPD:
+
{{#set: total reaction=10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03722 C03722]
+
{{#set: completion rate=20.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573883.html 4573883]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29959 29959]
+
−
* BIGG : quln
+
−
{{#set: smiles=C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=GJAWHXHKYYXBSV-UHFFFAOYSA-L}}
+
−
{{#set: common name=quinolinate}}
+
−
{{#set: molecular weight=165.105    }}
+
−
{{#set: common name=2,3-pyridinedicarboxylic acid|2,3-pyridinedicarboxylate|quinolinic acid|pyridine-2,3-dicarboxylic acid|pyridine-2,3-dicarboxylate}}
+
−
{{#set: consumed by=QUINOPRIBOTRANS-RXN}}
+
−
{{#set: produced by=RXN-5721}}
+

Revision as of 15:16, 21 March 2018

Pathway PWY-5288

  • taxonomic range:
  • common name:
    • astaxanthin biosynthesis (bacteria, fungi, algae)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PAPS&oldid=33216"