Difference between revisions of "AIRCARBOXY-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
| − | ** | + | ** pyrimidine nucleobases salvage I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** uracil salvage |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[URACIL-PRIBOSYLTRANS-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | + | *** [[Tiso_gene_10462]] | |
| − | * [[ | + | *** [[Tiso_gene_14867]] |
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7183 PWY-7183] |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: common name=pyrimidine nucleobases salvage I}} |
| − | {{#set: | + | {{#set: common name=uracil salvage}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: common name= | + | {{#set: total reaction=1}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:16, 21 March 2018
Pathway PWY-7183
- taxonomic range:
- common name:
- pyrimidine nucleobases salvage I
- Synonym(s):
- uracil salvage
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- URACIL-PRIBOSYLTRANS-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
