Difference between revisions of "Tiso gene 4516"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9663 RXN-9663] == * direction: ** LEFT-TO-RIGHT * common name: ** trans hexadecenoyl-[acp] redu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9663 RXN-9663] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
−
** gibberellin44 (open lactone form)
+
** trans hexadecenoyl-[acp] reductase
−
* molecular weight:
+
* ec number:
−
** 362.422   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A44 open lactone
 
−
** gibberellin A44 diacid
 
−
** GA44 open lactone
 
−
** GA44 (open lactone form)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-168]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[2-Hexadecenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Palmitoyl-ACPs]][c]
−
* [[RXN1F-167]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a trans hexadecenoyl-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a palmitoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170008
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=trans hexadecenoyl-[acp] reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
{{#set: ec number=EC-1.3.1.9}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_10778}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
{{#set: in pathway=PWY-5971}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|manual}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
{{#set: reconstruction source=manual-primary_network|orthology-esiliculosus}}
−
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
−
{{#set: common name=gibberellin44 (open lactone form)}}
+
−
{{#set: molecular weight=362.422    }}
+
−
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-168}}
+
−
{{#set: produced by=RXN1F-167}}
+

Revision as of 15:16, 21 March 2018

Reaction RXN-9663

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans hexadecenoyl-[acp] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans hexadecenoyl-[acp] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4516&oldid=33262"