Difference between revisions of "RXN-12252"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE N-ACETYL-D-GLUCOSAMINE] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(O)C(O)1) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_828 == * right end position: ** 27885 * transcription direction: ** POSITIVE * left end position: ** 21934 * centisome position: ** 76.7916...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_828 == |
| − | * | + | * right end position: |
| − | ** | + | ** 27885 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 21934 |
| − | * | + | * centisome position: |
| − | ** | + | ** 76.79166 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[5.99.1.3-RXN]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: ec-number |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=27885}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=21934}} | |
| − | + | {{#set: centisome position=76.79166 }} | |
| − | + | {{#set: reaction associated=5.99.1.3-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:17, 21 March 2018
Gene Tiso_gene_828
- right end position:
- 27885
- transcription direction:
- POSITIVE
- left end position:
- 21934
- centisome position:
- 76.79166
- Synonym(s):
Reactions associated
- Reaction: 5.99.1.3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
