Difference between revisions of "CPD-14808"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295] ==
* smiles:
+
* taxonomic range:
** C1(C(C(C(C(C1O)O)=O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** scyllo-inosose
+
** pyrimidine ribonucleosides degradation
* molecular weight:
+
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-keto-myo-inositol
 
** 2,4,6/3,5-pentahydroxycyclohexanone
 
** 2-inosose
 
** 2-keto-scyllo-inositol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[CYTIDEAM2-RXN]]
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[URPHOS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20384]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1295 PWY0-1295]
* CHEBI:
+
{{#set: taxonomic range=TAX-33208}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
+
{{#set: taxonomic range=TAX-2157}}
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
+
{{#set: common name=pyrimidine ribonucleosides degradation}}
{{#set: common name=scyllo-inosose}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=178.141    }}
+
{{#set: total reaction=2}}
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
+
{{#set: completion rate=100.0}}
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+

Revision as of 16:17, 21 March 2018

Pathway PWY0-1295

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links