Difference between revisions of "CPD-14808"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** pyrimidine ribonucleosides degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | + | * [[CYTIDEAM2-RXN]] | |
| − | * [[ | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[URPHOS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_20384]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1295 PWY0-1295] |
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: common name=pyrimidine ribonucleosides degradation}} |
| − | {{#set: common name= | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
Revision as of 15:17, 21 March 2018
Pathway PWY0-1295
- taxonomic range:
- common name:
- pyrimidine ribonucleosides degradation
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- CYTIDEAM2-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- URPHOS-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
