Difference between revisions of "PWY1F-467"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2562 RXN-2562] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2562 RXN-2562] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C1(CC1)[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/2.1.1.95 EC-2.1.1.95]
−
* common name:
+
−
** 1-aminocyclopropane-1-carboxylate
+
−
* molecular weight:
+
−
** 101.105   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-aminocyclopropane-1-carboxylic acid
 
−
** ACC
 
−
** 1-aminocyclopropanecarboxylic acid
 
−
** 1-aminocyclopropanecarboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[4.1.99.4-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DELTA-TOCOPHEROL]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[BETA-TOCOPHEROL]][c] '''+''' 1 [[PROTON]][c]
−
* [[4.4.1.14-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 δ-tocopherol[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 β-tocopherol[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6738]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-1422]], vitamin E biosynthesis (tocopherols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 22059-21-8
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07504 R07504]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB36458
+
{{#set: ec number=EC-2.1.1.95}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_6738}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234]
+
{{#set: in pathway=PWY-1422}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360]
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis}}
−
* METABOLIGHTS : MTBLC58360
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C([O-])(=O)C1(CC1)[N+]}}
+
−
{{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}}
+
−
{{#set: common name=1-aminocyclopropane-1-carboxylate}}
+
−
{{#set: molecular weight=101.105    }}
+
−
{{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}}
+
−
{{#set: consumed by=4.1.99.4-RXN}}
+
−
{{#set: produced by=4.4.1.14-RXN}}
+

Revision as of 15:18, 21 March 2018

Reaction RXN-2562

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1422, vitamin E biosynthesis (tocopherols): PWY-1422
    • 5 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY1F-467&oldid=33396"