Difference between revisions of "RXN-18301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** stachyose degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''7''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[GALACTOKIN-RXN]] | |
− | == Reaction(s) | + | ** 5 associated gene(s): |
+ | *** [[Tiso_gene_11795]] | ||
+ | *** [[Tiso_gene_12191]] | ||
+ | *** [[Tiso_gene_5041]] | ||
+ | *** [[Tiso_gene_10797]] | ||
+ | *** [[Tiso_gene_5042]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[GALACTURIDYLYLTRANS-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2435]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[GLUC1PURIDYLTRANS-RXN]] | ||
+ | ** 14 associated gene(s): | ||
+ | *** [[Tiso_gene_6459]] | ||
+ | *** [[Tiso_gene_4816]] | ||
+ | *** [[Tiso_gene_17531]] | ||
+ | *** [[Tiso_gene_5879]] | ||
+ | *** [[Tiso_gene_17566]] | ||
+ | *** [[Tiso_gene_16930]] | ||
+ | *** [[Tiso_gene_14796]] | ||
+ | *** [[Tiso_gene_9110]] | ||
+ | *** [[Tiso_gene_13477]] | ||
+ | *** [[Tiso_gene_7440]] | ||
+ | *** [[Tiso_gene_11401]] | ||
+ | *** [[Tiso_gene_6457]] | ||
+ | *** [[Tiso_gene_6458]] | ||
+ | *** [[Tiso_gene_7102]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-11501]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_16101]] | ||
+ | *** [[Tiso_gene_4615]] | ||
+ | *** [[Tiso_gene_8673]] | ||
+ | *** [[Tiso_gene_3392]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-11502]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_16101]] | ||
+ | *** [[Tiso_gene_4615]] | ||
+ | *** [[Tiso_gene_3392]] | ||
+ | *** [[Tiso_gene_8673]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[UDPGLUCEPIM-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_9823]] | ||
+ | *** [[Tiso_gene_15395]] | ||
+ | *** [[Tiso_gene_3236]] | ||
+ | *** [[Tiso_gene_10797]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[UTPHEXPURIDYLYLTRANS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_9110]] | ||
+ | *** [[Tiso_gene_6457]] | ||
+ | *** [[Tiso_gene_6459]] | ||
+ | *** [[Tiso_gene_14796]] | ||
+ | *** [[Tiso_gene_17566]] | ||
+ | *** [[Tiso_gene_6458]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=stachyose degradation}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:18, 21 March 2018
Pathway PWY-6527
- taxonomic range:
- common name:
- stachyose degradation
- Synonym(s):
Reaction(s) found
7 reactions found over 7 reactions in the full pathway
- GALACTOKIN-RXN
- 5 associated gene(s):
- 5 reconstruction source(s) associated:
- GALACTURIDYLYLTRANS-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- GLUC1PURIDYLTRANS-RXN
- 14 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-11501
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-11502
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- UDPGLUCEPIM-RXN
- 4 associated gene(s):
- 5 reconstruction source(s) associated:
- UTPHEXPURIDYLYLTRANS-RXN
- 6 associated gene(s):
- 2 reconstruction source(s) associated: