Difference between revisions of "RXN-18301"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC(=O)OC(=CC(=O)[O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
+
 
* common name:
 
* common name:
−
** trans-dienelactone
+
** stachyose degradation
−
* molecular weight:
+
−
** 139.087   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-trans-dienelactone
 
−
** trans-4-carboxymethylenebut-2-en-1,4-olide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9868]]
+
'''7''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[GALACTOKIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[Tiso_gene_11795]]
 +
*** [[Tiso_gene_12191]]
 +
*** [[Tiso_gene_5041]]
 +
*** [[Tiso_gene_10797]]
 +
*** [[Tiso_gene_5042]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2435]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
** 14 associated gene(s):
 +
*** [[Tiso_gene_6459]]
 +
*** [[Tiso_gene_4816]]
 +
*** [[Tiso_gene_17531]]
 +
*** [[Tiso_gene_5879]]
 +
*** [[Tiso_gene_17566]]
 +
*** [[Tiso_gene_16930]]
 +
*** [[Tiso_gene_14796]]
 +
*** [[Tiso_gene_9110]]
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_7440]]
 +
*** [[Tiso_gene_11401]]
 +
*** [[Tiso_gene_6457]]
 +
*** [[Tiso_gene_6458]]
 +
*** [[Tiso_gene_7102]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11501]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_16101]]
 +
*** [[Tiso_gene_4615]]
 +
*** [[Tiso_gene_8673]]
 +
*** [[Tiso_gene_3392]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11502]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_16101]]
 +
*** [[Tiso_gene_4615]]
 +
*** [[Tiso_gene_3392]]
 +
*** [[Tiso_gene_8673]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_9823]]
 +
*** [[Tiso_gene_15395]]
 +
*** [[Tiso_gene_3236]]
 +
*** [[Tiso_gene_10797]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_9110]]
 +
*** [[Tiso_gene_6457]]
 +
*** [[Tiso_gene_6459]]
 +
*** [[Tiso_gene_14796]]
 +
*** [[Tiso_gene_17566]]
 +
*** [[Tiso_gene_6458]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
+
{{#set: common name=stachyose degradation}}
−
* CHEMSPIDER:
+
{{#set: reaction found=7}}
−
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
+
{{#set: total reaction=7}}
−
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
+
−
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
+
−
{{#set: common name=trans-dienelactone}}
+
−
{{#set: molecular weight=139.087    }}
+
−
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
+
−
{{#set: consumed by=RXN-9868}}
+

Revision as of 15:18, 21 March 2018

Pathway PWY-6527

  • taxonomic range:
  • common name:
    • stachyose degradation
  • Synonym(s):

Reaction(s) found

7 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-18301&oldid=33427"