Difference between revisions of "RXN1G-1130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** chlorophyll cycle |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** chlorophyll b biosynthesis |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''4''' reaction(s) found |
− | * [[ | + | ** [[RXN1F-66]] |
− | == Reaction(s) | + | ** [[RXN-7677]] |
− | * [ | + | ** [[RXN-7676]] |
− | = | + | ** [[RXN-7674]] |
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7679 RXN-7679] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7678 RXN-7678] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5068 PWY-5068] |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-33682}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=chlorophyll cycle}} | |
− | + | {{#set: common name=chlorophyll b biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: reaction not found=2}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:36, 10 January 2018
Pathway PWY-5068
- taxonomic range:
- common name:
- chlorophyll cycle
- Synonym(s):
- chlorophyll b biosynthesis
Reaction(s) found
Reaction(s) not found
External links
- ARACYC: