Difference between revisions of "Tiso gene 14246"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Methionylaminoacyl-tRNAs L-Methionylaminoacyl-tRNAs] == * common name: ** a L-methionylaminoa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * common name:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == |
+ | * smiles: | ||
+ | ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) | ||
* common name: | * common name: | ||
− | ** | + | ** cyclobutadipyrimidine |
+ | * inchi key: | ||
+ | ** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 238.246 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[3. | + | * [[3.2.2.17-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by=3. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923] | ||
+ | {{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}} | ||
+ | {{#set: common name=cyclobutadipyrimidine}} | ||
+ | {{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=238.246 }} | ||
+ | {{#set: produced by=3.2.2.17-RXN}} |
Revision as of 15:21, 21 March 2018
Contents
Metabolite CPD-15526
- smiles:
- CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
- common name:
- cyclobutadipyrimidine
- inchi key:
- InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
- molecular weight:
- 238.246
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links