Difference between revisions of "D-aminoacyl-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_1416 == * right end position: ** 14051 * transcription direction: ** POSITIVE * left end position: ** 11700 * centisome position: ** 49.184...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_1416 == |
| − | * | + | * right end position: |
| − | ** | + | ** 14051 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 11700 |
| − | * | + | * centisome position: |
| − | ** | + | ** 49.184464 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[2.4.2.31-RXN]] | |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | + | *** Assignment: ec-number | |
| − | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=14051}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=11700}} | |
| − | + | {{#set: centisome position=49.184464 }} | |
| − | {{#set: | + | {{#set: reaction associated=2.4.2.31-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:22, 21 March 2018
Gene Tiso_gene_1416
- right end position:
- 14051
- transcription direction:
- POSITIVE
- left end position:
- 11700
- centisome position:
- 49.184464
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.31-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
