Difference between revisions of "Tiso gene 2478"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] == * smiles: ** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] ==
* smiles:
+
* taxonomic range:
** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
* inchi key:
+
** InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
+
 
* common name:
 
* common name:
** D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
+
** melatonin degradation I
* molecular weight:
+
** 403.391   
+
 
* Synonym(s):
 
* Synonym(s):
** D-pHPG-L-Ser-L-pHPG
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
* [[RXN-17832]]
+
* [[RXN-11056]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_1035]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11057]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1035]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11058]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5505]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11059]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5505]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11060]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14141]]
 +
*** [[Tiso_gene_14140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)}}
+
* LIGAND-MAP:
{{#set: inchi key=InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?map00380 map00380]
{{#set: common name=D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
+
{{#set: taxonomic range=TAX-7742}}
{{#set: molecular weight=403.391    }}
+
{{#set: common name=melatonin degradation I}}
{{#set: common name=D-pHPG-L-Ser-L-pHPG}}
+
{{#set: reaction found=5}}
{{#set: produced by=RXN-17832}}
+
{{#set: total reaction=5}}
 +
{{#set: completion rate=100.0}}

Revision as of 15:23, 21 March 2018

Pathway PWY-6398

  • taxonomic range:
  • common name:
    • melatonin degradation I
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links