Difference between revisions of "GUANYLCYC-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] ==
* smiles:
+
* direction:
** C1(NC=NC=1CC(CO)[N+])
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
* common name:
+
** histidinol
+
* molecular weight:
+
** 142.18   
+
 
* Synonym(s):
 
* Synonym(s):
** histidol
 
** L-histidinol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-8001]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''=>''' 1 [[PALMITYL-COA]][c] '''+''' 1 [[ACP]][c]
* [[HISTIDPHOS-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 coenzyme A[c] '''+''' 1 a palmitoyl-[acp][c] '''=>''' 1 palmitoyl-CoA[c] '''+''' 1 a holo-[acyl-carrier protein][c]
* [[HISTOLDEHYD-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7746]], mycobacterial sulfolipid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7746 PWY-7746]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* CAS : 501-28-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: in pathway=PWY-7746|PWY-5994}}
* KNAPSACK : C00007479
+
{{#set: reconstruction category=gap-filling}}
* HMDB : HMDB03431
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=meneco}}
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
{{#set: reconstruction comment=added for gapfilling}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
* BIGG : histd
+
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
{{#set: common name=histidinol}}
+
{{#set: molecular weight=142.18    }}
+
{{#set: common name=histidol|L-histidinol}}
+
{{#set: consumed by=RXN-8001}}
+
{{#set: produced by=HISTIDPHOS-RXN}}
+
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}
+

Revision as of 15:23, 21 March 2018

Reaction RXN3O-9780

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 a palmitoyl-[acp][c] => 1 palmitoyl-CoA[c] + 1 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Pathways

  • PWY-7746, mycobacterial sulfolipid biosynthesis: PWY-7746
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links