Difference between revisions of "PWY-1361"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 9,15,9'-tri-cis-ζ-carotene |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 540.914 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 9,15,9'-cis-ζ-carotene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11354]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12244]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19764 C19764] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48717 48717] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24755586 24755586] |
| − | {{#set: smiles= | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=9,15,9'-tri-cis-ζ-carotene}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=540.914 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=9,15,9'-cis-ζ-carotene}} |
| + | {{#set: consumed by=RXN-11354}} | ||
| + | {{#set: produced by=RXN-12244}} | ||
Revision as of 15:24, 21 March 2018
Contents
Metabolite CPD-7535
- smiles:
- CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C
- inchi key:
- InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N
- common name:
- 9,15,9'-tri-cis-ζ-carotene
- molecular weight:
- 540.914
- Synonym(s):
- 9,15,9'-cis-ζ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
