Difference between revisions of "DIACETYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...")
(Created page with "Category:Gene == Gene Tiso_gene_1471 == * right end position: ** 5675 * transcription direction: ** POSITIVE * left end position: ** 3909 * centisome position: ** 16.48810...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
+
== Gene Tiso_gene_1471 ==
−
* smiles:
+
* right end position:
−
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
+
** 5675
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (+)-taxifolin
+
** 3909
−
* molecular weight:
+
* centisome position:
−
** 303.248    
+
** 16.488106    
 
* Synonym(s):
 
* Synonym(s):
−
** trans dihydroquercetin
 
−
** (+)-dihydroquercetin
 
−
** taxifolin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-527]]
+
* Reaction: [[PMPOXI-RXN]]
−
* [[RXN-600]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[RXN-7775]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PNPOXI-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7204]]
 +
* [[PWY-7282]]
 +
* [[PLPSAL-PWY]]
 +
* [[PYRIDOXSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 480-18-2
+
{{#set: right end position=5675}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
+
{{#set: left end position=3909}}
−
* CHEBI:
+
{{#set: centisome position=16.488106   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
+
{{#set: reaction associated=PMPOXI-RXN|PNPOXI-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
+
−
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
+
−
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
+
−
{{#set: common name=(+)-taxifolin}}
+
−
{{#set: molecular weight=303.248   }}
+
−
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
+
−
{{#set: consumed by=RXN-527|RXN-600}}
+
−
{{#set: produced by=RXN-7775}}
+

Revision as of 16:26, 21 March 2018

Gene Tiso_gene_1471

  • right end position:
    • 5675
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3909
  • centisome position:
    • 16.488106
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIACETYL&oldid=34196"