Difference between revisions of "Tiso gene 7049"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == * smiles: ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14484 RXN-14484] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14484 RXN-14484] ==
−
* smiles:
+
* direction:
−
** CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K
+
 
* common name:
 
* common name:
−
** N-acetyl-β-neuraminate 9-phosphate
+
** chloroplast_beta-keto_acyl_reductase
−
* molecular weight:
+
* ec number:
−
** 386.229   
+
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-β-neuraminate-9-P
 
−
** N-acetyl-β-neuraminic acid 9-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-9988]]
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-14300]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CPD-15361]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 3-oxo-(11Z)-eicos-11-enoyl-CoA[c] '''+''' 1 NADPH[c] '''=>''' 1 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9871]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 +
** '''4''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06241 C06241]
+
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.330}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27438 27438]
+
{{#set: gene associated=Tiso_gene_9871}}
−
* METABOLIGHTS : MTBLC27438
+
{{#set: in pathway=PWY-6433}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658964 90658964]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* HMDB : HMDB04381
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)}}
+
−
{{#set: inchi key=InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K}}
+
−
{{#set: common name=N-acetyl-β-neuraminate 9-phosphate}}
+
−
{{#set: molecular weight=386.229    }}
+
−
{{#set: common name=N-acetyl-β-neuraminate-9-P|N-acetyl-β-neuraminic acid 9-phosphate}}
+
−
{{#set: produced by=RXN-9988}}
+

Revision as of 15:27, 21 March 2018

Reaction RXN-14484

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chloroplast_beta-keto_acyl_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 3-oxo-(11Z)-eicos-11-enoyl-CoA[c] + 1 NADPH[c] => 1 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6433, hydroxylated fatty acid biosynthesis (plants): PWY-6433
    • 4 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7049&oldid=34300"