Difference between revisions of "RXN1G-1057"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE D-RIBULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE D-RIBULOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C(O)C(O)C(=O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
−
** InChIKey=ZAQJHHRNXZUBTE-NQXXGFSBSA-N
+
 
* common name:
 
* common name:
−
** D-ribulose
+
** cholesterol biosynthesis I
−
* molecular weight:
+
−
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-erythro-pentulose
 
−
** D-erythropentulose
 
−
** erythropentulose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''22''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[1.14.21.6-RXN]]
−
* [[D-RIBULOKIN-RXN]]
+
** 1 associated gene(s):
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
*** [[Tiso_gene_5446]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-303]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-304]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-305]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-306]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-313]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-318]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-323]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-320 RXN66-320]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-321 RXN66-321]
 
== External links  ==
 
== External links  ==
−
* CAS : 5556-48-9
+
{{#set: taxonomic range=TAX-33208}}
−
* PUBCHEM:
+
{{#set: common name=cholesterol biosynthesis I}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151261 151261]
+
{{#set: reaction found=8}}
−
* HMDB : HMDB00621
+
{{#set: total reaction=22}}
−
* LIGAND-CPD:
+
{{#set: completion rate=36.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00309 C00309]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.133316.html 133316]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17173 17173]
+
−
* METABOLIGHTS : MTBLC17173
+
−
{{#set: smiles=C(O)C(O)C(O)C(=O)CO}}
+
−
{{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-NQXXGFSBSA-N}}
+
−
{{#set: common name=D-ribulose}}
+
−
{{#set: molecular weight=150.131    }}
+
−
{{#set: common name=D-erythro-pentulose|D-erythropentulose|erythropentulose}}
+
−
{{#set: reversible reaction associated=D-RIBULOKIN-RXN|RIBITOL-2-DEHYDROGENASE-RXN}}
+

Revision as of 15:28, 21 March 2018

Pathway PWY66-341

  • taxonomic range:
  • common name:
    • cholesterol biosynthesis I
  • Synonym(s):

Reaction(s) found

8 reactions found over 22 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-1057&oldid=34342"