Difference between revisions of "PWY-7546"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DMPH DMPH] == * direction: ** REVERSIBLE * common name: ** 2'-Deoxyguanosine 5'-monophosphate phosp...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DMPH DMPH] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2'-Deoxyguanosine 5'-monophosphate phosphohydrolase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[DGMP]][c] '''<=>''' 1.0 [[DEOXYGUANOSINE]][c] '''+''' 1.0 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 H2O[c] '''+''' 1.0 dGMP[c] '''<=>''' 1.0 2'-deoxyguanosine[c] '''+''' 1.0 phosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_6988]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_9166]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=2'-Deoxyguanosine 5'-monophosphate phosphohydrolase}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_6988|Tiso_gene_9166}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:29, 21 March 2018
Contents
Reaction DMPH
- direction:
- REVERSIBLE
- common name:
- 2'-Deoxyguanosine 5'-monophosphate phosphohydrolase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 DGMP[c] <=> 1.0 DEOXYGUANOSINE[c] + 1.0 Pi[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 dGMP[c] <=> 1.0 2'-deoxyguanosine[c] + 1.0 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6988
- Source: orthology-creinhardtii
- Gene: Tiso_gene_9166
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
