Difference between revisions of "PWY-7268"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** diphthamide biosynthesis (eukaryotes) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[DIPHTINE--AMMONIA-LIGASE-RXN]] |
| − | * [ | + | ** 1 associated gene(s): |
| − | * [ | + | *** [[Tiso_gene_3764]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15775 RXN-15775] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15776 RXN-15776] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=diphthamide biosynthesis (eukaryotes)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:30, 21 March 2018
Pathway PWY-7546
- taxonomic range:
- common name:
- diphthamide biosynthesis (eukaryotes)
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- DIPHTINE--AMMONIA-LIGASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
